C12H16ClNO4S2 — CID 102704222
4-[4-(chloromethyl)-2-methoxyphenyl]sulfonyl-1,4-thiazinane 1-oxide (PubChem CID 102704222) has the molecular formula C12H16ClNO4S2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 4-[4-(chloromethyl)-2-methoxyphenyl]sulfonyl-1,4-thiazinane 1-oxide.
| Compound Name | 4-[4-(chloromethyl)-2-methoxyphenyl]sulfonyl-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 102704222 |
| Molecular Formula | C12H16ClNO4S2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 4-[4-(chloromethyl)-2-methoxyphenyl]sulfonyl-1,4-thiazinane 1-oxide |
| SMILES | COc1cc(CCl)ccc1S(=O)(=O)N1CCS(=O)CC1 |
| InChI | InChI=1S/C12H16ClNO4S2/c1-18-11-8-10(9-13)2-3-12(11)20(16,17)14-4-6-19(15)7-5-14/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | AXAYEXPWZOPKGU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|