C17H17NS — CID 81153387
1-(1-benzothiophen-7-yl)-N-methyl-1-(3-methylphenyl)methanamine (PubChem CID 81153387) has the molecular formula C17H17NS and a molecular weight of 267.40 g/mol. Its IUPAC name is 1-(1-benzothiophen-7-yl)-N-methyl-1-(3-methylphenyl)methanamine.
| Compound Name | 1-(1-benzothiophen-7-yl)-N-methyl-1-(3-methylphenyl)methanamine |
|---|---|
| PubChem CID | 81153387 |
| Molecular Formula | C17H17NS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1-(1-benzothiophen-7-yl)-N-methyl-1-(3-methylphenyl)methanamine |
| SMILES | CNC(c1cccc(C)c1)c1cccc2ccsc12 |
| InChI | InChI=1S/C17H17NS/c1-12-5-3-7-14(11-12)16(18-2)15-8-4-6-13-9-10-19-17(13)15/h3-11,16,18H,1-2H3 |
| InChIKey | HFEZDMOELDEESB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |