C14H13NOS — CID 81154346
1-(1-benzothiophen-7-yl)-1-(furan-2-yl)-N-methylmethanamine (PubChem CID 81154346) has the molecular formula C14H13NOS and a molecular weight of 243.33 g/mol. Its IUPAC name is 1-(1-benzothiophen-7-yl)-1-(furan-2-yl)-N-methylmethanamine.
| Compound Name | 1-(1-benzothiophen-7-yl)-1-(furan-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 81154346 |
| Molecular Formula | C14H13NOS |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 1-(1-benzothiophen-7-yl)-1-(furan-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1ccco1)c1cccc2ccsc12 |
| InChI | InChI=1S/C14H13NOS/c1-15-13(12-6-3-8-16-12)11-5-2-4-10-7-9-17-14(10)11/h2-9,13,15H,1H3 |
| InChIKey | ZSXSYKNUYTWJEN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |