C12H20N4O5 — CID 81156346
2-[1-[[bis(2-amino-2-oxoethyl)carbamoylamino]methyl]cyclobutyl]acetic acid (PubChem CID 81156346) has the molecular formula C12H20N4O5 and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-[1-[[bis(2-amino-2-oxoethyl)carbamoylamino]methyl]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[[bis(2-amino-2-oxoethyl)carbamoylamino]methyl]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 81156346 |
| Molecular Formula | C12H20N4O5 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-[1-[[bis(2-amino-2-oxoethyl)carbamoylamino]methyl]cyclobutyl]acetic acid |
| SMILES | NC(=O)CN(CC(N)=O)C(=O)NCC1(CC(=O)O)CCC1 |
| InChI | InChI=1S/C12H20N4O5/c13-8(17)5-16(6-9(14)18)11(21)15-7-12(2-1-3-12)4-10(19)20/h1-7H2,(H2,13,17)(H2,14,18)(H,15,21)(H,19,20) |
| InChIKey | YUWDINWKTPARKF-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 155.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |