C14H17ClFNO3 — CID 81157408
4-[(3-chloro-4-fluorophenyl)methyl-ethylamino]oxolane-3-carboxylic acid (PubChem CID 81157408) has the molecular formula C14H17ClFNO3 and a molecular weight of 301.75 g/mol. Its IUPAC name is 4-[(3-chloro-4-fluorophenyl)methyl-ethylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(3-chloro-4-fluorophenyl)methyl-ethylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 81157408 |
| Molecular Formula | C14H17ClFNO3 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 4-[(3-chloro-4-fluorophenyl)methyl-ethylamino]oxolane-3-carboxylic acid |
| SMILES | CCN(Cc1ccc(F)c(Cl)c1)C1COCC1C(=O)O |
| InChI | InChI=1S/C14H17ClFNO3/c1-2-17(13-8-20-7-10(13)14(18)19)6-9-3-4-12(16)11(15)5-9/h3-5,10,13H,2,6-8H2,1H3,(H,18,19) |
| InChIKey | FBABYSNOFVKWET-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |