C16H24ClFN2 — CID 81159300
2-(3-chloro-4-fluorophenyl)-1-(2-methylpropyl)azepan-3-amine (PubChem CID 81159300) has the molecular formula C16H24ClFN2 and a molecular weight of 298.83 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-1-(2-methylpropyl)azepan-3-amine.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-1-(2-methylpropyl)azepan-3-amine |
|---|---|
| PubChem CID | 81159300 |
| Molecular Formula | C16H24ClFN2 |
| Molecular Weight | 298.83 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-1-(2-methylpropyl)azepan-3-amine |
| SMILES | CC(C)CN1CCCCC(N)C1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H24ClFN2/c1-11(2)10-20-8-4-3-5-15(19)16(20)12-6-7-14(18)13(17)9-12/h6-7,9,11,15-16H,3-5,8,10,19H2,1-2H3 |
| InChIKey | JTULWIUWEGTFTE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.83 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |