C16H24ClFN2 — CID 81159154
1-tert-butyl-2-(3-chloro-4-fluorophenyl)azepan-3-amine (PubChem CID 81159154) has the molecular formula C16H24ClFN2 and a molecular weight of 298.83 g/mol. Its IUPAC name is 1-tert-butyl-2-(3-chloro-4-fluorophenyl)azepan-3-amine.
| Compound Name | 1-tert-butyl-2-(3-chloro-4-fluorophenyl)azepan-3-amine |
|---|---|
| PubChem CID | 81159154 |
| Molecular Formula | C16H24ClFN2 |
| Molecular Weight | 298.83 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 1-tert-butyl-2-(3-chloro-4-fluorophenyl)azepan-3-amine |
| SMILES | CC(C)(C)N1CCCCC(N)C1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H24ClFN2/c1-16(2,3)20-9-5-4-6-14(19)15(20)11-7-8-13(18)12(17)10-11/h7-8,10,14-15H,4-6,9,19H2,1-3H3 |
| InChIKey | IOZNBRFGHSVDDF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.83 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |