C17H27BrN2 — CID 105411556
2-(3-bromo-4-methylphenyl)-1-tert-butylazepan-3-amine (PubChem CID 105411556) has the molecular formula C17H27BrN2 and a molecular weight of 339.32 g/mol. Its IUPAC name is 2-(3-bromo-4-methylphenyl)-1-tert-butylazepan-3-amine.
| Compound Name | 2-(3-bromo-4-methylphenyl)-1-tert-butylazepan-3-amine |
|---|---|
| PubChem CID | 105411556 |
| Molecular Formula | C17H27BrN2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-(3-bromo-4-methylphenyl)-1-tert-butylazepan-3-amine |
| SMILES | Cc1ccc(C2C(N)CCCCN2C(C)(C)C)cc1Br |
| InChI | InChI=1S/C17H27BrN2/c1-12-8-9-13(11-14(12)18)16-15(19)7-5-6-10-20(16)17(2,3)4/h8-9,11,15-16H,5-7,10,19H2,1-4H3 |
| InChIKey | ZGQTYCIDKHWTQL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |