C15H24ClNOS — CID 81160117
3-[2-chloro-4-[(2-methylpropylamino)methyl]phenyl]sulfanylbutan-1-ol (PubChem CID 81160117) has the molecular formula C15H24ClNOS and a molecular weight of 301.88 g/mol. Its IUPAC name is 3-[2-chloro-4-[(2-methylpropylamino)methyl]phenyl]sulfanylbutan-1-ol.
| Compound Name | 3-[2-chloro-4-[(2-methylpropylamino)methyl]phenyl]sulfanylbutan-1-ol |
|---|---|
| PubChem CID | 81160117 |
| Molecular Formula | C15H24ClNOS |
| Molecular Weight | 301.88 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 3-[2-chloro-4-[(2-methylpropylamino)methyl]phenyl]sulfanylbutan-1-ol |
| SMILES | CC(C)CNCc1ccc(SC(C)CCO)c(Cl)c1 |
| InChI | InChI=1S/C15H24ClNOS/c1-11(2)9-17-10-13-4-5-15(14(16)8-13)19-12(3)6-7-18/h4-5,8,11-12,17-18H,6-7,9-10H2,1-3H3 |
| InChIKey | RRFNHBZJACNFSZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.88 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |