C7H12N2O3 — CID 81167542
1-[(2-amino-2-oxoethyl)amino]cyclobutane-1-carboxylic acid (PubChem CID 81167542) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is 1-[(2-amino-2-oxoethyl)amino]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(2-amino-2-oxoethyl)amino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 81167542 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 1-[(2-amino-2-oxoethyl)amino]cyclobutane-1-carboxylic acid |
| SMILES | NC(=O)CNC1(C(=O)O)CCC1 |
| InChI | InChI=1S/C7H12N2O3/c8-5(10)4-9-7(6(11)12)2-1-3-7/h9H,1-4H2,(H2,8,10)(H,11,12) |
| InChIKey | SUXCLJPFIPIISX-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |