C8H14N2O3 — CID 82238244
1-[(2-amino-2-oxoethyl)amino]cyclopentane-1-carboxylic acid (PubChem CID 82238244) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-[(2-amino-2-oxoethyl)amino]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[(2-amino-2-oxoethyl)amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 82238244 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-[(2-amino-2-oxoethyl)amino]cyclopentane-1-carboxylic acid |
| SMILES | NC(=O)CNC1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C8H14N2O3/c9-6(11)5-10-8(7(12)13)3-1-2-4-8/h10H,1-5H2,(H2,9,11)(H,12,13) |
| InChIKey | ZVYDOPSJFKEXIS-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |