C8H18N2O2S — CID 81174658
2-(2-aminoethylsulfinyl)-N,N-diethylacetamide (PubChem CID 81174658) has the molecular formula C8H18N2O2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 2-(2-aminoethylsulfinyl)-N,N-diethylacetamide.
| Compound Name | 2-(2-aminoethylsulfinyl)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 81174658 |
| Molecular Formula | C8H18N2O2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-(2-aminoethylsulfinyl)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CS(=O)CCN |
| InChI | InChI=1S/C8H18N2O2S/c1-3-10(4-2)8(11)7-13(12)6-5-9/h3-7,9H2,1-2H3 |
| InChIKey | LWUKHXIPYUKMRL-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |