C10H13ClN2O2S — CID 81181559
2-(4-amino-2-chlorophenyl)sulfinylbutanamide (PubChem CID 81181559) has the molecular formula C10H13ClN2O2S and a molecular weight of 260.75 g/mol. Its IUPAC name is 2-(4-amino-2-chlorophenyl)sulfinylbutanamide.
| Compound Name | 2-(4-amino-2-chlorophenyl)sulfinylbutanamide |
|---|---|
| PubChem CID | 81181559 |
| Molecular Formula | C10H13ClN2O2S |
| Molecular Weight | 260.75 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-(4-amino-2-chlorophenyl)sulfinylbutanamide |
| SMILES | CCC(C(N)=O)S(=O)c1ccc(N)cc1Cl |
| InChI | InChI=1S/C10H13ClN2O2S/c1-2-8(10(13)14)16(15)9-4-3-6(12)5-7(9)11/h3-5,8H,2,12H2,1H3,(H2,13,14) |
| InChIKey | RAFDTAMHOZOKCU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.75 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|