C9H11Cl2NO2 — CID 67914619
3,4-dichloroaniline;propanoic acid (PubChem CID 67914619) has the molecular formula C9H11Cl2NO2 and a molecular weight of 236.10 g/mol. Its IUPAC name is 3,4-dichloroaniline;propanoic acid.
| Compound Name | 3,4-dichloroaniline;propanoic acid |
|---|---|
| PubChem CID | 67914619 |
| Molecular Formula | C9H11Cl2NO2 |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 3,4-dichloroaniline;propanoic acid |
| SMILES | CCC(=O)O.Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H5Cl2N.C3H6O2/c7-5-2-1-4(9)3-6(5)8;1-2-3(4)5/h1-3H,9H2;2H2,1H3,(H,4,5) |
| InChIKey | OSGXEZHGGDEXLZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|