C10H11Cl2NO3 — CID 70628865
3,4-dichloroaniline;3-oxobutanoic acid (PubChem CID 70628865) has the molecular formula C10H11Cl2NO3 and a molecular weight of 264.11 g/mol. Its IUPAC name is 3,4-dichloroaniline;3-oxobutanoic acid.
| Compound Name | 3,4-dichloroaniline;3-oxobutanoic acid |
|---|---|
| PubChem CID | 70628865 |
| Molecular Formula | C10H11Cl2NO3 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 3,4-dichloroaniline;3-oxobutanoic acid |
| SMILES | CC(=O)CC(=O)O.Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H5Cl2N.C4H6O3/c7-5-2-1-4(9)3-6(5)8;1-3(5)2-4(6)7/h1-3H,9H2;2H2,1H3,(H,6,7) |
| InChIKey | BDNXQQBTDUCEHY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|