3,4-dichloroaniline;3-oxobutanoic acid

C10H11Cl2NO3 — CID 70628865

IUPAC3,4-dichloroaniline;3-oxobutanoic acid
SMILESCC(=O)CC(=O)O.Nc1ccc(Cl)c(Cl)c1
InChIInChI=1S/C6H5Cl2N.C4H6O3/c7-5-2-1-4(9)3-6(5)8;1-3(5)2-4(6)7/h1-3H,9H2;2H2,1H3,(H,6,7)
InChIKeyBDNXQQBTDUCEHY-UHFFFAOYSA-N
MW264.11 g/mol
LogP2.63
Rot. Bonds2

About 3,4-dichloroaniline;3-oxobutanoic acid

3,4-dichloroaniline;3-oxobutanoic acid (PubChem CID 70628865) has the molecular formula C10H11Cl2NO3 and a molecular weight of 264.11 g/mol. Its IUPAC name is 3,4-dichloroaniline;3-oxobutanoic acid.

Molecular Properties

Compound Name3,4-dichloroaniline;3-oxobutanoic acid
PubChem CID70628865
Molecular FormulaC10H11Cl2NO3
Molecular Weight264.11 g/mol
Exact Mass263.01
IUPAC Name3,4-dichloroaniline;3-oxobutanoic acid
SMILESCC(=O)CC(=O)O.Nc1ccc(Cl)c(Cl)c1
InChIInChI=1S/C6H5Cl2N.C4H6O3/c7-5-2-1-4(9)3-6(5)8;1-3(5)2-4(6)7/h1-3H,9H2;2H2,1H3,(H,6,7)
InChIKeyBDNXQQBTDUCEHY-UHFFFAOYSA-N
XLogP2.63
TPSA80.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.11
LogP ≤ 52.63
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 3,4-dichloroaniline;3-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dichloroaniline;3-oxobutanoic acid?
The IUPAC name of 3,4-dichloroaniline;3-oxobutanoic acid (CID 70628865) is 3,4-dichloroaniline;3-oxobutanoic acid.
What is the SMILES notation for 3,4-dichloroaniline;3-oxobutanoic acid?
The canonical SMILES for 3,4-dichloroaniline;3-oxobutanoic acid is CC(=O)CC(=O)O.Nc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3,4-dichloroaniline;3-oxobutanoic acid?
The InChIKey is BDNXQQBTDUCEHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl2N.C4H6O3/c7-5-2-1-4(9)3-6(5)8;1-3(5)2-4(6)7/h1-3H,9H2;2H2,1H3,(H,6,7).
What are the key properties of 3,4-dichloroaniline;3-oxobutanoic acid?
3,4-dichloroaniline;3-oxobutanoic acid has a molecular weight of 264.11 g/mol, XLogP of 2.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichloroaniline;3-oxobutanoic acid is sourced from PubChem (CID 70628865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).