C15H14FNO3S — CID 81184831
4-(2,3-dihydro-1-benzofuran-2-ylmethylsulfonyl)-3-fluoroaniline (PubChem CID 81184831) has the molecular formula C15H14FNO3S and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-2-ylmethylsulfonyl)-3-fluoroaniline.
| Compound Name | 4-(2,3-dihydro-1-benzofuran-2-ylmethylsulfonyl)-3-fluoroaniline |
|---|---|
| PubChem CID | 81184831 |
| Molecular Formula | C15H14FNO3S |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-2-ylmethylsulfonyl)-3-fluoroaniline |
| SMILES | Nc1ccc(S(=O)(=O)CC2Cc3ccccc3O2)c(F)c1 |
| InChI | InChI=1S/C15H14FNO3S/c16-13-8-11(17)5-6-15(13)21(18,19)9-12-7-10-3-1-2-4-14(10)20-12/h1-6,8,12H,7,9,17H2 |
| InChIKey | LRTSNQFYGKQKFU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|