C13H17FN4O2S — CID 81184834
3-fluoro-4-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylsulfonyl]aniline (PubChem CID 81184834) has the molecular formula C13H17FN4O2S and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-fluoro-4-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylsulfonyl]aniline.
| Compound Name | 3-fluoro-4-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylsulfonyl]aniline |
|---|---|
| PubChem CID | 81184834 |
| Molecular Formula | C13H17FN4O2S |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-fluoro-4-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methylsulfonyl]aniline |
| SMILES | CC(C)Cn1ncnc1CS(=O)(=O)c1ccc(N)cc1F |
| InChI | InChI=1S/C13H17FN4O2S/c1-9(2)6-18-13(16-8-17-18)7-21(19,20)12-4-3-10(15)5-11(12)14/h3-5,8-9H,6-7,15H2,1-2H3 |
| InChIKey | YEJHSPUDFAPFFI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|