C14H17BrClN3OS — CID 81185650
2-[(4-bromo-1,3-diethylpyrazol-5-yl)methylsulfinyl]-3-chloroaniline (PubChem CID 81185650) has the molecular formula C14H17BrClN3OS and a molecular weight of 390.73 g/mol. Its IUPAC name is 2-[(4-bromo-1,3-diethylpyrazol-5-yl)methylsulfinyl]-3-chloroaniline.
| Compound Name | 2-[(4-bromo-1,3-diethylpyrazol-5-yl)methylsulfinyl]-3-chloroaniline |
|---|---|
| PubChem CID | 81185650 |
| Molecular Formula | C14H17BrClN3OS |
| Molecular Weight | 390.73 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | 2-[(4-bromo-1,3-diethylpyrazol-5-yl)methylsulfinyl]-3-chloroaniline |
| SMILES | CCc1nn(CC)c(CS(=O)c2c(N)cccc2Cl)c1Br |
| InChI | InChI=1S/C14H17BrClN3OS/c1-3-11-13(15)12(19(4-2)18-11)8-21(20)14-9(16)6-5-7-10(14)17/h5-7H,3-4,8,17H2,1-2H3 |
| InChIKey | BQRWKONAGQLKGM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.73 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|