C15H20BrN3OS — CID 81184973
4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylsulfinyl]-2-methylaniline (PubChem CID 81184973) has the molecular formula C15H20BrN3OS and a molecular weight of 370.32 g/mol. Its IUPAC name is 4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylsulfinyl]-2-methylaniline.
| Compound Name | 4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylsulfinyl]-2-methylaniline |
|---|---|
| PubChem CID | 81184973 |
| Molecular Formula | C15H20BrN3OS |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 4-[(4-bromo-1,3-diethylpyrazol-5-yl)methylsulfinyl]-2-methylaniline |
| SMILES | CCc1nn(CC)c(CS(=O)c2ccc(N)c(C)c2)c1Br |
| InChI | InChI=1S/C15H20BrN3OS/c1-4-13-15(16)14(19(5-2)18-13)9-21(20)11-6-7-12(17)10(3)8-11/h6-8H,4-5,9,17H2,1-3H3 |
| InChIKey | NIQCENGIAXYOMN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|