C14H17BrN2OS2 — CID 81185809
5-bromo-2-[(4-tert-butyl-1,3-thiazol-2-yl)methylsulfinyl]aniline (PubChem CID 81185809) has the molecular formula C14H17BrN2OS2 and a molecular weight of 373.34 g/mol. Its IUPAC name is 5-bromo-2-[(4-tert-butyl-1,3-thiazol-2-yl)methylsulfinyl]aniline.
| Compound Name | 5-bromo-2-[(4-tert-butyl-1,3-thiazol-2-yl)methylsulfinyl]aniline |
|---|---|
| PubChem CID | 81185809 |
| Molecular Formula | C14H17BrN2OS2 |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 5-bromo-2-[(4-tert-butyl-1,3-thiazol-2-yl)methylsulfinyl]aniline |
| SMILES | CC(C)(C)c1csc(CS(=O)c2ccc(Br)cc2N)n1 |
| InChI | InChI=1S/C14H17BrN2OS2/c1-14(2,3)12-7-19-13(17-12)8-20(18)11-5-4-9(15)6-10(11)16/h4-7H,8,16H2,1-3H3 |
| InChIKey | JWHFQQCIMHZVBF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|