C10H13N3OS — CID 81187209
3-(3-aminopropylsulfinylmethyl)pyridine-2-carbonitrile (PubChem CID 81187209) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 3-(3-aminopropylsulfinylmethyl)pyridine-2-carbonitrile.
| Compound Name | 3-(3-aminopropylsulfinylmethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 81187209 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 3-(3-aminopropylsulfinylmethyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1ncccc1CS(=O)CCCN |
| InChI | InChI=1S/C10H13N3OS/c11-4-2-6-15(14)8-9-3-1-5-13-10(9)7-12/h1,3,5H,2,4,6,8,11H2 |
| InChIKey | IPNDEXWFDXAONR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 79.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |