C9H20N2O2S — CID 81187704
2-(1-aminopropan-2-ylsulfinyl)-N-tert-butylacetamide (PubChem CID 81187704) has the molecular formula C9H20N2O2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 2-(1-aminopropan-2-ylsulfinyl)-N-tert-butylacetamide.
| Compound Name | 2-(1-aminopropan-2-ylsulfinyl)-N-tert-butylacetamide |
|---|---|
| PubChem CID | 81187704 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-(1-aminopropan-2-ylsulfinyl)-N-tert-butylacetamide |
| SMILES | CC(CN)S(=O)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C9H20N2O2S/c1-7(5-10)14(13)6-8(12)11-9(2,3)4/h7H,5-6,10H2,1-4H3,(H,11,12) |
| InChIKey | DRGVHLQIHBWJQJ-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |