C16H17NO2S — CID 81192305
2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylsulfonyl)-5-methylaniline (PubChem CID 81192305) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylsulfonyl)-5-methylaniline.
| Compound Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylsulfonyl)-5-methylaniline |
|---|---|
| PubChem CID | 81192305 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethylsulfonyl)-5-methylaniline |
| SMILES | Cc1ccc(S(=O)(=O)CC2Cc3ccccc32)c(N)c1 |
| InChI | InChI=1S/C16H17NO2S/c1-11-6-7-16(15(17)8-11)20(18,19)10-13-9-12-4-2-3-5-14(12)13/h2-8,13H,9-10,17H2,1H3 |
| InChIKey | LYOGCWPEPSONSJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|