C11H13F3N2O3S — CID 81192842
2-(2-amino-4-methylphenyl)sulfonyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 81192842) has the molecular formula C11H13F3N2O3S and a molecular weight of 310.30 g/mol. Its IUPAC name is 2-(2-amino-4-methylphenyl)sulfonyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(2-amino-4-methylphenyl)sulfonyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 81192842 |
| Molecular Formula | C11H13F3N2O3S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2-(2-amino-4-methylphenyl)sulfonyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)CC(=O)NCC(F)(F)F)c(N)c1 |
| InChI | InChI=1S/C11H13F3N2O3S/c1-7-2-3-9(8(15)4-7)20(18,19)5-10(17)16-6-11(12,13)14/h2-4H,5-6,15H2,1H3,(H,16,17) |
| InChIKey | DQOYTOFZPYSFJQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|