C13H25NO3S2 — CID 81193985
1-(1-oxa-9-thiaspiro[5.5]undecan-4-ylsulfonyl)butan-2-amine (PubChem CID 81193985) has the molecular formula C13H25NO3S2 and a molecular weight of 307.48 g/mol. Its IUPAC name is 1-(1-oxa-9-thiaspiro[5.5]undecan-4-ylsulfonyl)butan-2-amine.
| Compound Name | 1-(1-oxa-9-thiaspiro[5.5]undecan-4-ylsulfonyl)butan-2-amine |
|---|---|
| PubChem CID | 81193985 |
| Molecular Formula | C13H25NO3S2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 1-(1-oxa-9-thiaspiro[5.5]undecan-4-ylsulfonyl)butan-2-amine |
| SMILES | CCC(N)CS(=O)(=O)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C13H25NO3S2/c1-2-11(14)10-19(15,16)12-3-6-17-13(9-12)4-7-18-8-5-13/h11-12H,2-10,14H2,1H3 |
| InChIKey | AIQZLHCMGOCWKO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |