C11H21N3O2S — CID 81194177
4-[(1-propan-2-ylpyrazol-3-yl)methylsulfonyl]butan-2-amine (PubChem CID 81194177) has the molecular formula C11H21N3O2S and a molecular weight of 259.38 g/mol. Its IUPAC name is 4-[(1-propan-2-ylpyrazol-3-yl)methylsulfonyl]butan-2-amine.
| Compound Name | 4-[(1-propan-2-ylpyrazol-3-yl)methylsulfonyl]butan-2-amine |
|---|---|
| PubChem CID | 81194177 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 4-[(1-propan-2-ylpyrazol-3-yl)methylsulfonyl]butan-2-amine |
| SMILES | CC(N)CCS(=O)(=O)Cc1ccn(C(C)C)n1 |
| InChI | InChI=1S/C11H21N3O2S/c1-9(2)14-6-4-11(13-14)8-17(15,16)7-5-10(3)12/h4,6,9-10H,5,7-8,12H2,1-3H3 |
| InChIKey | FEVLDJCMMLMCQY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |