C11H13Cl2NOS — CID 81196456
3-[(2,4-dichlorophenyl)methylsulfinylmethyl]azetidine (PubChem CID 81196456) has the molecular formula C11H13Cl2NOS and a molecular weight of 278.20 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methylsulfinylmethyl]azetidine.
| Compound Name | 3-[(2,4-dichlorophenyl)methylsulfinylmethyl]azetidine |
|---|---|
| PubChem CID | 81196456 |
| Molecular Formula | C11H13Cl2NOS |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methylsulfinylmethyl]azetidine |
| SMILES | O=S(Cc1ccc(Cl)cc1Cl)CC1CNC1 |
| InChI | InChI=1S/C11H13Cl2NOS/c12-10-2-1-9(11(13)3-10)7-16(15)6-8-4-14-5-8/h1-3,8,14H,4-7H2 |
| InChIKey | JFMZAEWORGGDMR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |