C17H33N3 — CID 81199726
2,2-dimethyl-5-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]cyclopentan-1-amine (PubChem CID 81199726) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]cyclopentan-1-amine.
| Compound Name | 2,2-dimethyl-5-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 81199726 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | 2,2-dimethyl-5-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]cyclopentan-1-amine |
| SMILES | CN1CCCC2CN(CC3CCC(C)(C)C3N)CCC21 |
| InChI | InChI=1S/C17H33N3/c1-17(2)8-6-14(16(17)18)12-20-10-7-15-13(11-20)5-4-9-19(15)3/h13-16H,4-12,18H2,1-3H3 |
| InChIKey | ZIYFPQVGMKNIHH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |