C18H33BrN2 — CID 81200320
6-[[1-(bromomethyl)cycloheptyl]methyl]-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine (PubChem CID 81200320) has the molecular formula C18H33BrN2 and a molecular weight of 357.38 g/mol. Its IUPAC name is 6-[[1-(bromomethyl)cycloheptyl]methyl]-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine.
| Compound Name | 6-[[1-(bromomethyl)cycloheptyl]methyl]-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 81200320 |
| Molecular Formula | C18H33BrN2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 6-[[1-(bromomethyl)cycloheptyl]methyl]-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine |
| SMILES | CN1CCCC2CN(CC3(CBr)CCCCCC3)CCC21 |
| InChI | InChI=1S/C18H33BrN2/c1-20-11-6-7-16-13-21(12-8-17(16)20)15-18(14-19)9-4-2-3-5-10-18/h16-17H,2-15H2,1H3 |
| InChIKey | WNMNWXTWBLNBHS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|