C9H17N3O2S — CID 81202080
2-methyl-3-[(1-methylpyrazol-4-yl)methylsulfonyl]propan-1-amine (PubChem CID 81202080) has the molecular formula C9H17N3O2S and a molecular weight of 231.32 g/mol. Its IUPAC name is 2-methyl-3-[(1-methylpyrazol-4-yl)methylsulfonyl]propan-1-amine.
| Compound Name | 2-methyl-3-[(1-methylpyrazol-4-yl)methylsulfonyl]propan-1-amine |
|---|---|
| PubChem CID | 81202080 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-methyl-3-[(1-methylpyrazol-4-yl)methylsulfonyl]propan-1-amine |
| SMILES | CC(CN)CS(=O)(=O)Cc1cnn(C)c1 |
| InChI | InChI=1S/C9H17N3O2S/c1-8(3-10)6-15(13,14)7-9-4-11-12(2)5-9/h4-5,8H,3,6-7,10H2,1-2H3 |
| InChIKey | OJFSNRVZQBQISW-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |