C9H15N3O2S — CID 81197067
4-(azetidin-3-ylmethylsulfonylmethyl)-1-methylpyrazole (PubChem CID 81197067) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 4-(azetidin-3-ylmethylsulfonylmethyl)-1-methylpyrazole.
| Compound Name | 4-(azetidin-3-ylmethylsulfonylmethyl)-1-methylpyrazole |
|---|---|
| PubChem CID | 81197067 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 4-(azetidin-3-ylmethylsulfonylmethyl)-1-methylpyrazole |
| SMILES | Cn1cc(CS(=O)(=O)CC2CNC2)cn1 |
| InChI | InChI=1S/C9H15N3O2S/c1-12-5-9(4-11-12)7-15(13,14)6-8-2-10-3-8/h4-5,8,10H,2-3,6-7H2,1H3 |
| InChIKey | ZEDCYVJLAQGDFA-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |