C12H17ClN2O4S — CID 81202537
2-(5-amino-2-chlorophenyl)sulfonyl-N-(2-methoxyethyl)propanamide (PubChem CID 81202537) has the molecular formula C12H17ClN2O4S and a molecular weight of 320.80 g/mol. Its IUPAC name is 2-(5-amino-2-chlorophenyl)sulfonyl-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-(5-amino-2-chlorophenyl)sulfonyl-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 81202537 |
| Molecular Formula | C12H17ClN2O4S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 2-(5-amino-2-chlorophenyl)sulfonyl-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)S(=O)(=O)c1cc(N)ccc1Cl |
| InChI | InChI=1S/C12H17ClN2O4S/c1-8(12(16)15-5-6-19-2)20(17,18)11-7-9(14)3-4-10(11)13/h3-4,7-8H,5-6,14H2,1-2H3,(H,15,16) |
| InChIKey | XCNGLNLXCCFUMI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|