C13H14F3NO3 — CID 81202743
[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-(3,4,5-trifluorophenyl)methanone (PubChem CID 81202743) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is [2-(hydroxymethyl)-5-methylmorpholin-4-yl]-(3,4,5-trifluorophenyl)methanone.
| Compound Name | [2-(hydroxymethyl)-5-methylmorpholin-4-yl]-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 81202743 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | [2-(hydroxymethyl)-5-methylmorpholin-4-yl]-(3,4,5-trifluorophenyl)methanone |
| SMILES | CC1COC(CO)CN1C(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H14F3NO3/c1-7-6-20-9(5-18)4-17(7)13(19)8-2-10(14)12(16)11(15)3-8/h2-3,7,9,18H,4-6H2,1H3 |
| InChIKey | BXFBGYXQBQULGB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|