C13H18ClN3O3 — CID 81213227
[2-chloro-6-(methylamino)-4-pyridinyl]-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]methanone (PubChem CID 81213227) has the molecular formula C13H18ClN3O3 and a molecular weight of 299.76 g/mol. Its IUPAC name is [2-chloro-6-(methylamino)-4-pyridinyl]-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]methanone.
| Compound Name | [2-chloro-6-(methylamino)-4-pyridinyl]-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 81213227 |
| Molecular Formula | C13H18ClN3O3 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | [2-chloro-6-(methylamino)-4-pyridinyl]-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]methanone |
| SMILES | CNc1cc(C(=O)N2CC(CO)OCC2C)cc(Cl)n1 |
| InChI | InChI=1S/C13H18ClN3O3/c1-8-7-20-10(6-18)5-17(8)13(19)9-3-11(14)16-12(4-9)15-2/h3-4,8,10,18H,5-7H2,1-2H3,(H,15,16) |
| InChIKey | DHJLJPUJXYTBNJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|