C9H18N2O3 — CID 81202762
1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-2-(methylamino)ethanone (PubChem CID 81202762) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-2-(methylamino)ethanone.
| Compound Name | 1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-2-(methylamino)ethanone |
|---|---|
| PubChem CID | 81202762 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-2-(methylamino)ethanone |
| SMILES | CNCC(=O)N1CC(CO)OCC1C |
| InChI | InChI=1S/C9H18N2O3/c1-7-6-14-8(5-12)4-11(7)9(13)3-10-2/h7-8,10,12H,3-6H2,1-2H3 |
| InChIKey | FLVUAXZKGNSDBA-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |