C9H15NO5 — CID 81212677
3-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-3-oxopropanoic acid (PubChem CID 81212677) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is 3-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-3-oxopropanoic acid.
| Compound Name | 3-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 81212677 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 3-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-3-oxopropanoic acid |
| SMILES | CC1COC(CO)CN1C(=O)CC(=O)O |
| InChI | InChI=1S/C9H15NO5/c1-6-5-15-7(4-11)3-10(6)8(12)2-9(13)14/h6-7,11H,2-5H2,1H3,(H,13,14) |
| InChIKey | BCESUQKGJSDTFS-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|