C10H18N2O5 — CID 81204807
3-[[2-(hydroxymethyl)-5-methylmorpholine-4-carbonyl]amino]propanoic acid (PubChem CID 81204807) has the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. Its IUPAC name is 3-[[2-(hydroxymethyl)-5-methylmorpholine-4-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[2-(hydroxymethyl)-5-methylmorpholine-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 81204807 |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-[[2-(hydroxymethyl)-5-methylmorpholine-4-carbonyl]amino]propanoic acid |
| SMILES | CC1COC(CO)CN1C(=O)NCCC(=O)O |
| InChI | InChI=1S/C10H18N2O5/c1-7-6-17-8(5-13)4-12(7)10(16)11-3-2-9(14)15/h7-8,13H,2-6H2,1H3,(H,11,16)(H,14,15) |
| InChIKey | OUYPBSVUPMTRIJ-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |