C11H21ClN2O2S — CID 81205615
6-(2-chloroethylsulfonyl)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine (PubChem CID 81205615) has the molecular formula C11H21ClN2O2S and a molecular weight of 280.82 g/mol. Its IUPAC name is 6-(2-chloroethylsulfonyl)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine.
| Compound Name | 6-(2-chloroethylsulfonyl)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 81205615 |
| Molecular Formula | C11H21ClN2O2S |
| Molecular Weight | 280.82 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 6-(2-chloroethylsulfonyl)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine |
| SMILES | CN1CCCC2CN(S(=O)(=O)CCCl)CCC21 |
| InChI | InChI=1S/C11H21ClN2O2S/c1-13-6-2-3-10-9-14(7-4-11(10)13)17(15,16)8-5-12/h10-11H,2-9H2,1H3 |
| InChIKey | IRHKOZGCKHMQMB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.82 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|