C9H15NO4 — CID 81209419
prop-2-enyl 2-(hydroxymethyl)morpholine-4-carboxylate (PubChem CID 81209419) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is prop-2-enyl 2-(hydroxymethyl)morpholine-4-carboxylate.
| Compound Name | prop-2-enyl 2-(hydroxymethyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 81209419 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | prop-2-enyl 2-(hydroxymethyl)morpholine-4-carboxylate |
| SMILES | C=CCOC(=O)N1CCOC(CO)C1 |
| InChI | InChI=1S/C9H15NO4/c1-2-4-14-9(12)10-3-5-13-8(6-10)7-11/h2,8,11H,1,3-7H2 |
| InChIKey | MCXJJRGMAOKTFA-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|