C9H13NO5 — CID 81203259
(E)-4-[2-(hydroxymethyl)morpholin-4-yl]-4-oxobut-2-enoic acid (PubChem CID 81203259) has the molecular formula C9H13NO5 and a molecular weight of 215.20 g/mol. Its IUPAC name is (E)-4-[2-(hydroxymethyl)morpholin-4-yl]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-(hydroxymethyl)morpholin-4-yl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 81203259 |
| Molecular Formula | C9H13NO5 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | (E)-4-[2-(hydroxymethyl)morpholin-4-yl]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)N1CCOC(CO)C1 |
| InChI | InChI=1S/C9H13NO5/c11-6-7-5-10(3-4-15-7)8(12)1-2-9(13)14/h1-2,7,11H,3-6H2,(H,13,14)/b2-1+ |
| InChIKey | JMEHLDBFLWSTLK-OWOJBTEDSA-N |
| XLogP | -1.15 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|