C16H19N3O — CID 81210048
1,4-diazabicyclo[2.2.2]octan-2-yl(quinolin-7-yl)methanol (PubChem CID 81210048) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 1,4-diazabicyclo[2.2.2]octan-2-yl(quinolin-7-yl)methanol.
| Compound Name | 1,4-diazabicyclo[2.2.2]octan-2-yl(quinolin-7-yl)methanol |
|---|---|
| PubChem CID | 81210048 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 1,4-diazabicyclo[2.2.2]octan-2-yl(quinolin-7-yl)methanol |
| SMILES | OC(c1ccc2cccnc2c1)C1CN2CCN1CC2 |
| InChI | InChI=1S/C16H19N3O/c20-16(15-11-18-6-8-19(15)9-7-18)13-4-3-12-2-1-5-17-14(12)10-13/h1-5,10,15-16,20H,6-9,11H2 |
| InChIKey | WZYXRGNKIXNSCT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |