C10H10Br2ClNO2S — CID 81210944
[2-(chloromethyl)morpholin-4-yl]-(4,5-dibromothiophen-2-yl)methanone (PubChem CID 81210944) has the molecular formula C10H10Br2ClNO2S and a molecular weight of 403.52 g/mol. Its IUPAC name is [2-(chloromethyl)morpholin-4-yl]-(4,5-dibromothiophen-2-yl)methanone.
| Compound Name | [2-(chloromethyl)morpholin-4-yl]-(4,5-dibromothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 81210944 |
| Molecular Formula | C10H10Br2ClNO2S |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 400.85 |
| IUPAC Name | [2-(chloromethyl)morpholin-4-yl]-(4,5-dibromothiophen-2-yl)methanone |
| SMILES | O=C(c1cc(Br)c(Br)s1)N1CCOC(CCl)C1 |
| InChI | InChI=1S/C10H10Br2ClNO2S/c11-7-3-8(17-9(7)12)10(15)14-1-2-16-6(4-13)5-14/h3,6H,1-2,4-5H2 |
| InChIKey | OIYAVCZHMHFTHX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|