C13H18ClNO3 — CID 81212458
1-[2-(chloromethyl)-5-methylmorpholin-4-yl]-3-(furan-2-yl)propan-1-one (PubChem CID 81212458) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is 1-[2-(chloromethyl)-5-methylmorpholin-4-yl]-3-(furan-2-yl)propan-1-one.
| Compound Name | 1-[2-(chloromethyl)-5-methylmorpholin-4-yl]-3-(furan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 81212458 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-[2-(chloromethyl)-5-methylmorpholin-4-yl]-3-(furan-2-yl)propan-1-one |
| SMILES | CC1COC(CCl)CN1C(=O)CCc1ccco1 |
| InChI | InChI=1S/C13H18ClNO3/c1-10-9-18-12(7-14)8-15(10)13(16)5-4-11-3-2-6-17-11/h2-3,6,10,12H,4-5,7-9H2,1H3 |
| InChIKey | ULEZSAPBCOMBFG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|