C9H19N3O2 — CID 81213883
N'-ethyl-2-(hydroxymethyl)-5-methylmorpholine-4-carboximidamide (PubChem CID 81213883) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is N'-ethyl-2-(hydroxymethyl)-5-methylmorpholine-4-carboximidamide.
| Compound Name | N'-ethyl-2-(hydroxymethyl)-5-methylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 81213883 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N'-ethyl-2-(hydroxymethyl)-5-methylmorpholine-4-carboximidamide |
| SMILES | CC/N=C(\N)N1CC(CO)OCC1C |
| InChI | InChI=1S/C9H19N3O2/c1-3-11-9(10)12-4-8(5-13)14-6-7(12)2/h7-8,13H,3-6H2,1-2H3,(H2,10,11) |
| InChIKey | KPJUYVRKNLMSTD-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|