C15H22N2O — CID 81215579
N-methyl-N-(oxan-4-yl)-1,2,3,4-tetrahydroquinolin-6-amine (PubChem CID 81215579) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is N-methyl-N-(oxan-4-yl)-1,2,3,4-tetrahydroquinolin-6-amine.
| Compound Name | N-methyl-N-(oxan-4-yl)-1,2,3,4-tetrahydroquinolin-6-amine |
|---|---|
| PubChem CID | 81215579 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | N-methyl-N-(oxan-4-yl)-1,2,3,4-tetrahydroquinolin-6-amine |
| SMILES | CN(c1ccc2c(c1)CCCN2)C1CCOCC1 |
| InChI | InChI=1S/C15H22N2O/c1-17(13-6-9-18-10-7-13)14-4-5-15-12(11-14)3-2-8-16-15/h4-5,11,13,16H,2-3,6-10H2,1H3 |
| InChIKey | NKALZZBUBPVZGB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |