C12H19N3O — CID 81217599
[5-methyl-4-(3-methyl-4-pyridinyl)morpholin-2-yl]methanamine (PubChem CID 81217599) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is [5-methyl-4-(3-methyl-4-pyridinyl)morpholin-2-yl]methanamine.
| Compound Name | [5-methyl-4-(3-methyl-4-pyridinyl)morpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 81217599 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | [5-methyl-4-(3-methyl-4-pyridinyl)morpholin-2-yl]methanamine |
| SMILES | Cc1cnccc1N1CC(CN)OCC1C |
| InChI | InChI=1S/C12H19N3O/c1-9-6-14-4-3-12(9)15-7-11(5-13)16-8-10(15)2/h3-4,6,10-11H,5,7-8,13H2,1-2H3 |
| InChIKey | UDMMFBDCLYVFTD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |