C10H16N4O2 — CID 81218492
[4-(6-aminopyrimidin-4-yl)-5-methylmorpholin-2-yl]methanol (PubChem CID 81218492) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is [4-(6-aminopyrimidin-4-yl)-5-methylmorpholin-2-yl]methanol.
| Compound Name | [4-(6-aminopyrimidin-4-yl)-5-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81218492 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | [4-(6-aminopyrimidin-4-yl)-5-methylmorpholin-2-yl]methanol |
| SMILES | CC1COC(CO)CN1c1cc(N)ncn1 |
| InChI | InChI=1S/C10H16N4O2/c1-7-5-16-8(4-15)3-14(7)10-2-9(11)12-6-13-10/h2,6-8,15H,3-5H2,1H3,(H2,11,12,13) |
| InChIKey | KLQJGYBKUPJXML-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |