C12H15BrN2O4 — CID 81218880
[4-(4-bromo-2-nitrophenyl)-5-methylmorpholin-2-yl]methanol (PubChem CID 81218880) has the molecular formula C12H15BrN2O4 and a molecular weight of 331.17 g/mol. Its IUPAC name is [4-(4-bromo-2-nitrophenyl)-5-methylmorpholin-2-yl]methanol.
| Compound Name | [4-(4-bromo-2-nitrophenyl)-5-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81218880 |
| Molecular Formula | C12H15BrN2O4 |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | [4-(4-bromo-2-nitrophenyl)-5-methylmorpholin-2-yl]methanol |
| SMILES | CC1COC(CO)CN1c1ccc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15BrN2O4/c1-8-7-19-10(6-16)5-14(8)11-3-2-9(13)4-12(11)15(17)18/h2-4,8,10,16H,5-7H2,1H3 |
| InChIKey | MOZZJSCXCYPXPX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|