C12H14F2N2O4 — CID 81219444
[4-(2,3-difluoro-6-nitrophenyl)-5-methylmorpholin-2-yl]methanol (PubChem CID 81219444) has the molecular formula C12H14F2N2O4 and a molecular weight of 288.25 g/mol. Its IUPAC name is [4-(2,3-difluoro-6-nitrophenyl)-5-methylmorpholin-2-yl]methanol.
| Compound Name | [4-(2,3-difluoro-6-nitrophenyl)-5-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81219444 |
| Molecular Formula | C12H14F2N2O4 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | [4-(2,3-difluoro-6-nitrophenyl)-5-methylmorpholin-2-yl]methanol |
| SMILES | CC1COC(CO)CN1c1c([N+](=O)[O-])ccc(F)c1F |
| InChI | InChI=1S/C12H14F2N2O4/c1-7-6-20-8(5-17)4-15(7)12-10(16(18)19)3-2-9(13)11(12)14/h2-3,7-8,17H,4-6H2,1H3 |
| InChIKey | CQUJFHPENORFMR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|