C14H22N2O4 — CID 81219868
N-(furan-2-ylmethyl)-2-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-N-methylacetamide (PubChem CID 81219868) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-N-methylacetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 81219868 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-N-methylacetamide |
| SMILES | CC1COC(CO)CN1CC(=O)N(C)Cc1ccco1 |
| InChI | InChI=1S/C14H22N2O4/c1-11-10-20-13(9-17)7-16(11)8-14(18)15(2)6-12-4-3-5-19-12/h3-5,11,13,17H,6-10H2,1-2H3 |
| InChIKey | HHEDJXSXTRWWNA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |